C12H15FO5 — CID 117398829
ethyl 2-(3-fluoro-2,6-dimethoxyphenyl)-2-hydroxyacetate (PubChem CID 117398829) has the molecular formula C12H15FO5 and a molecular weight of 258.24 g/mol. Its IUPAC name is ethyl 2-(3-fluoro-2,6-dimethoxyphenyl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(3-fluoro-2,6-dimethoxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117398829 |
| Molecular Formula | C12H15FO5 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | ethyl 2-(3-fluoro-2,6-dimethoxyphenyl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1c(OC)ccc(F)c1OC |
| InChI | InChI=1S/C12H15FO5/c1-4-18-12(15)10(14)9-8(16-2)6-5-7(13)11(9)17-3/h5-6,10,14H,4H2,1-3H3 |
| InChIKey | KFGRGYUZCWBOKH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |