C14H18N4O — CID 117399583
3-[4-(piperazin-1-ylmethyl)phenyl]-1,2-oxazol-5-amine (PubChem CID 117399583) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[4-(piperazin-1-ylmethyl)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[4-(piperazin-1-ylmethyl)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117399583 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[4-(piperazin-1-ylmethyl)phenyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2ccc(CN3CCNCC3)cc2)no1 |
| InChI | InChI=1S/C14H18N4O/c15-14-9-13(17-19-14)12-3-1-11(2-4-12)10-18-7-5-16-6-8-18/h1-4,9,16H,5-8,10,15H2 |
| InChIKey | JTPJTLQRRJBXHR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |