C14H14N2OS — CID 117399672
7-(1-isocyanatocyclopentyl)-2-methyl-1,3-benzothiazole (PubChem CID 117399672) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 7-(1-isocyanatocyclopentyl)-2-methyl-1,3-benzothiazole.
| Compound Name | 7-(1-isocyanatocyclopentyl)-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 117399672 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 7-(1-isocyanatocyclopentyl)-2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2cccc(C3(N=C=O)CCCC3)c2s1 |
| InChI | InChI=1S/C14H14N2OS/c1-10-16-12-6-4-5-11(13(12)18-10)14(15-9-17)7-2-3-8-14/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | ZQWGQSGCAVKMHR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|