C16H22N2O — CID 117399770
1-methyl-5-(piperidin-4-ylmethyl)-3,4-dihydroquinolin-2-one (PubChem CID 117399770) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-methyl-5-(piperidin-4-ylmethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-methyl-5-(piperidin-4-ylmethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 117399770 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-methyl-5-(piperidin-4-ylmethyl)-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2c(CC3CCNCC3)cccc21 |
| InChI | InChI=1S/C16H22N2O/c1-18-15-4-2-3-13(14(15)5-6-16(18)19)11-12-7-9-17-10-8-12/h2-4,12,17H,5-11H2,1H3 |
| InChIKey | JAZMAXIOJXRBGA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |