About methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate
methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate (PubChem CID 11739994) has the molecular formula C18H21NO5S
and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate.
Molecular Properties
| Compound Name | methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate |
| PubChem CID | 11739994 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate |
| SMILES | COC(=O)C#CCN(CC1=CCOCC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-15-5-7-17(8-6-15)25(21,22)19(11-3-4-18(20)23-2)14-16-9-12-24-13-10-16/h5-9H,10-14H2,1-2H3 |
| InChIKey | PAIQKZFHTLGLCH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate?
The IUPAC name of methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate (CID 11739994) is methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate.
What is the SMILES notation for methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate?
The canonical SMILES for methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate is COC(=O)C#CCN(CC1=CCOCC1)S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate?
The InChIKey is PAIQKZFHTLGLCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO5S/c1-15-5-7-17(8-6-15)25(21,22)19(11-3-4-18(20)23-2)14-16-9-12-24-13-10-16/h5-9H,10-14H2,1-2H3.
What are the key properties of methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate?
methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate has a molecular weight of 363.44 g/mol, XLogP of 1.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]but-2-ynoate is sourced from PubChem (CID 11739994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).