C12H15ClO4 — CID 117400516
3-(4-chloro-2-hydroxy-3-methoxy-6-methylphenyl)-2-methylpropanoic acid (PubChem CID 117400516) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is 3-(4-chloro-2-hydroxy-3-methoxy-6-methylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(4-chloro-2-hydroxy-3-methoxy-6-methylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117400516 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-(4-chloro-2-hydroxy-3-methoxy-6-methylphenyl)-2-methylpropanoic acid |
| SMILES | COc1c(Cl)cc(C)c(CC(C)C(=O)O)c1O |
| InChI | InChI=1S/C12H15ClO4/c1-6-5-9(13)11(17-3)10(14)8(6)4-7(2)12(15)16/h5,7,14H,4H2,1-3H3,(H,15,16) |
| InChIKey | QRAHBUSAGUSAMY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |