C17H12ClN3O3S — CID 11740089
N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 11740089) has the molecular formula C17H12ClN3O3S and a molecular weight of 373.82 g/mol. Its IUPAC name is N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 11740089 |
| Molecular Formula | C17H12ClN3O3S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNc1nc(-c2ccc(Cl)cc2)cs1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H12ClN3O3S/c18-12-4-1-10(2-5-12)13-8-25-17(19-13)21-20-16(22)11-3-6-14-15(7-11)24-9-23-14/h1-8H,9H2,(H,19,21)(H,20,22) |
| InChIKey | RMXATTXHJHYTDJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|