About 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid
4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid (PubChem CID 117401230) has the molecular formula C12H15F2NO3
and a molecular weight of 259.25 g/mol. Its IUPAC name is 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid.
Molecular Properties
| Compound Name | 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid |
| PubChem CID | 117401230 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid |
| SMILES | COCc1ccc(C(N)CCC(=O)O)c(F)c1F |
| InChI | InChI=1S/C12H15F2NO3/c1-18-6-7-2-3-8(12(14)11(7)13)9(15)4-5-10(16)17/h2-3,9H,4-6,15H2,1H3,(H,16,17) |
| InChIKey | WOUNEACXRYXWNR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid?
The IUPAC name of 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid (CID 117401230) is 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid.
What is the SMILES notation for 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid?
The canonical SMILES for 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid is COCc1ccc(C(N)CCC(=O)O)c(F)c1F.
What is the InChIKey of 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid?
The InChIKey is WOUNEACXRYXWNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NO3/c1-18-6-7-2-3-8(12(14)11(7)13)9(15)4-5-10(16)17/h2-3,9H,4-6,15H2,1H3,(H,16,17).
What are the key properties of 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid?
4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid has a molecular weight of 259.25 g/mol, XLogP of 1.98, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-[2,3-difluoro-4-(methoxymethyl)phenyl]butanoic acid is sourced from PubChem (CID 117401230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).