C23H34O4 — CID 11740143
(4aS,6aS,12S,12aS,12bS)-10,12-dimethoxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-9-ol (PubChem CID 11740143) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (4aS,6aS,12S,12aS,12bS)-10,12-dimethoxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-9-ol.
| Compound Name | (4aS,6aS,12S,12aS,12bS)-10,12-dimethoxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-9-ol |
|---|---|
| PubChem CID | 11740143 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (4aS,6aS,12S,12aS,12bS)-10,12-dimethoxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-9-ol |
| SMILES | COc1cc2c(cc1O)O[C@@]1(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]1[C@@H]2OC |
| InChI | InChI=1S/C23H34O4/c1-21(2)9-7-10-22(3)18(21)8-11-23(4)20(22)19(26-6)14-12-17(25-5)15(24)13-16(14)27-23/h12-13,18-20,24H,7-11H2,1-6H3/t18-,19+,20+,22-,23-/m0/s1 |
| InChIKey | JAGJWSBNJZPDNL-FCSJJDFTSA-N |
| XLogP | 5.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |