C11H14FNO3S — CID 117401591
3-amino-2-(2-fluoro-4-methoxy-3-methylsulfanylphenyl)propanoic acid (PubChem CID 117401591) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-amino-2-(2-fluoro-4-methoxy-3-methylsulfanylphenyl)propanoic acid.
| Compound Name | 3-amino-2-(2-fluoro-4-methoxy-3-methylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117401591 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-amino-2-(2-fluoro-4-methoxy-3-methylsulfanylphenyl)propanoic acid |
| SMILES | COc1ccc(C(CN)C(=O)O)c(F)c1SC |
| InChI | InChI=1S/C11H14FNO3S/c1-16-8-4-3-6(7(5-13)11(14)15)9(12)10(8)17-2/h3-4,7H,5,13H2,1-2H3,(H,14,15) |
| InChIKey | VTZOKKYECORZDC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |