C14H17Br2NO — CID 11740160
(1S,9S,13S)-3,5-dibromo-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol (PubChem CID 11740160) has the molecular formula C14H17Br2NO and a molecular weight of 375.10 g/mol. Its IUPAC name is (1S,9S,13S)-3,5-dibromo-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol.
| Compound Name | (1S,9S,13S)-3,5-dibromo-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 11740160 |
| Molecular Formula | C14H17Br2NO |
| Molecular Weight | 375.10 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | (1S,9S,13S)-3,5-dibromo-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol |
| SMILES | C[C@@H]1[C@@H]2Cc3cc(Br)c(O)c(Br)c3[C@@]1(C)CCN2 |
| InChI | InChI=1S/C14H17Br2NO/c1-7-10-6-8-5-9(15)13(18)12(16)11(8)14(7,2)3-4-17-10/h5,7,10,17-18H,3-4,6H2,1-2H3/t7-,10+,14+/m1/s1 |
| InChIKey | NSFBWBWTAIDXMI-IMIVBSTGSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.10 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |