About 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine
2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine (PubChem CID 11740300) has the molecular formula C20H22Cl2N2O
and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine |
| PubChem CID | 11740300 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine |
| SMILES | Cc1c(OCCN(C)C)c2cc(Cl)cc(Cl)c2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H22Cl2N2O/c1-14-20(25-10-9-23(2)3)17-11-16(21)12-18(22)19(17)24(14)13-15-7-5-4-6-8-15/h4-8,11-12H,9-10,13H2,1-3H3 |
| InChIKey | OLMBJUCMVUKOBF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine?
The IUPAC name of 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine (CID 11740300) is 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine.
What is the SMILES notation for 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine?
The canonical SMILES for 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine is Cc1c(OCCN(C)C)c2cc(Cl)cc(Cl)c2n1Cc1ccccc1.
What is the InChIKey of 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine?
The InChIKey is OLMBJUCMVUKOBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N2O/c1-14-20(25-10-9-23(2)3)17-11-16(21)12-18(22)19(17)24(14)13-15-7-5-4-6-8-15/h4-8,11-12H,9-10,13H2,1-3H3.
What are the key properties of 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine?
2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine has a molecular weight of 377.32 g/mol, XLogP of 5.25, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzyl-5,7-dichloro-2-methylindol-3-yl)oxy-N,N-dimethylethanamine is sourced from PubChem (CID 11740300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).