C11H8ClF2NO2 — CID 117403183
1-chloro-2,3-difluoro-5-(1-isocyanatocyclopropyl)-4-methoxybenzene (PubChem CID 117403183) has the molecular formula C11H8ClF2NO2 and a molecular weight of 259.64 g/mol. Its IUPAC name is 1-chloro-2,3-difluoro-5-(1-isocyanatocyclopropyl)-4-methoxybenzene.
| Compound Name | 1-chloro-2,3-difluoro-5-(1-isocyanatocyclopropyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 117403183 |
| Molecular Formula | C11H8ClF2NO2 |
| Molecular Weight | 259.64 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 1-chloro-2,3-difluoro-5-(1-isocyanatocyclopropyl)-4-methoxybenzene |
| SMILES | COc1c(C2(N=C=O)CC2)cc(Cl)c(F)c1F |
| InChI | InChI=1S/C11H8ClF2NO2/c1-17-10-6(11(2-3-11)15-5-16)4-7(12)8(13)9(10)14/h4H,2-3H2,1H3 |
| InChIKey | VHKABXUCBSDQEA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|