C12H18ClNO3 — CID 117403574
2-(2-chloro-3,4,6-trimethoxyphenyl)-N-methylethanamine (PubChem CID 117403574) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 2-(2-chloro-3,4,6-trimethoxyphenyl)-N-methylethanamine.
| Compound Name | 2-(2-chloro-3,4,6-trimethoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 117403574 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-(2-chloro-3,4,6-trimethoxyphenyl)-N-methylethanamine |
| SMILES | CNCCc1c(OC)cc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C12H18ClNO3/c1-14-6-5-8-9(15-2)7-10(16-3)12(17-4)11(8)13/h7,14H,5-6H2,1-4H3 |
| InChIKey | VDOIFXVTUMKWHN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |