C9H10BrNO3 — CID 117403820
N-[(7-bromo-6-methyl-1,3-benzodioxol-5-yl)methyl]hydroxylamine (PubChem CID 117403820) has the molecular formula C9H10BrNO3 and a molecular weight of 260.09 g/mol. Its IUPAC name is N-[(7-bromo-6-methyl-1,3-benzodioxol-5-yl)methyl]hydroxylamine.
| Compound Name | N-[(7-bromo-6-methyl-1,3-benzodioxol-5-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117403820 |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | N-[(7-bromo-6-methyl-1,3-benzodioxol-5-yl)methyl]hydroxylamine |
| SMILES | Cc1c(CNO)cc2c(c1Br)OCO2 |
| InChI | InChI=1S/C9H10BrNO3/c1-5-6(3-11-12)2-7-9(8(5)10)14-4-13-7/h2,11-12H,3-4H2,1H3 |
| InChIKey | VMCAGTIVNWAMCY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|