C12H15Cl2NO — CID 117404130
[1-(2,5-dichloro-3-methoxyphenyl)cyclobutyl]methanamine (PubChem CID 117404130) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is [1-(2,5-dichloro-3-methoxyphenyl)cyclobutyl]methanamine.
| Compound Name | [1-(2,5-dichloro-3-methoxyphenyl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 117404130 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | [1-(2,5-dichloro-3-methoxyphenyl)cyclobutyl]methanamine |
| SMILES | COc1cc(Cl)cc(C2(CN)CCC2)c1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c1-16-10-6-8(13)5-9(11(10)14)12(7-15)3-2-4-12/h5-6H,2-4,7,15H2,1H3 |
| InChIKey | ZMSUKADVONZFOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |