About 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol
8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol (PubChem CID 117404601) has the molecular formula C15H16O4
and a molecular weight of 260.29 g/mol. Its IUPAC name is 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol.
Molecular Properties
| Compound Name | 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol |
| PubChem CID | 117404601 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol |
| SMILES | Cc1cc2c(CCCO)c3oc(C)cc3c(O)c2o1 |
| InChI | InChI=1S/C15H16O4/c1-8-6-11-10(4-3-5-16)14-12(7-9(2)18-14)13(17)15(11)19-8/h6-7,16-17H,3-5H2,1-2H3 |
| InChIKey | SBASGDAABINKQJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol?
The IUPAC name of 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol (CID 117404601) is 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol.
What is the SMILES notation for 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol?
The canonical SMILES for 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol is Cc1cc2c(CCCO)c3oc(C)cc3c(O)c2o1.
What is the InChIKey of 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol?
The InChIKey is SBASGDAABINKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O4/c1-8-6-11-10(4-3-5-16)14-12(7-9(2)18-14)13(17)15(11)19-8/h6-7,16-17H,3-5H2,1-2H3.
What are the key properties of 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol?
8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol has a molecular weight of 260.29 g/mol, XLogP of 3.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-hydroxypropyl)-2,6-dimethylfuro[2,3-f][1]benzofuran-4-ol is sourced from PubChem (CID 117404601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).