C17H24O2 — CID 117405464
3-[2-(4,4-dimethylcyclohexyl)phenyl]propanoic acid (PubChem CID 117405464) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-[2-(4,4-dimethylcyclohexyl)phenyl]propanoic acid.
| Compound Name | 3-[2-(4,4-dimethylcyclohexyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117405464 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 3-[2-(4,4-dimethylcyclohexyl)phenyl]propanoic acid |
| SMILES | CC1(C)CCC(c2ccccc2CCC(=O)O)CC1 |
| InChI | InChI=1S/C17H24O2/c1-17(2)11-9-14(10-12-17)15-6-4-3-5-13(15)7-8-16(18)19/h3-6,14H,7-12H2,1-2H3,(H,18,19) |
| InChIKey | PHPQZJDKSAWDDH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |