C17H24O2 — CID 117405507
3-cyclopropyl-3-(3-pentan-3-ylphenyl)propanoic acid (PubChem CID 117405507) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-cyclopropyl-3-(3-pentan-3-ylphenyl)propanoic acid.
| Compound Name | 3-cyclopropyl-3-(3-pentan-3-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117405507 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 3-cyclopropyl-3-(3-pentan-3-ylphenyl)propanoic acid |
| SMILES | CCC(CC)c1cccc(C(CC(=O)O)C2CC2)c1 |
| InChI | InChI=1S/C17H24O2/c1-3-12(4-2)14-6-5-7-15(10-14)16(11-17(18)19)13-8-9-13/h5-7,10,12-13,16H,3-4,8-9,11H2,1-2H3,(H,18,19) |
| InChIKey | SYIUZWHPLKLZMG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |