C23H24FNO3 — CID 11740566
6-[4-(2-fluorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid (PubChem CID 11740566) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is 6-[4-(2-fluorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid.
| Compound Name | 6-[4-(2-fluorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 11740566 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 6-[4-(2-fluorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCOc1cc(-c2ccccc2F)c2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C23H24FNO3/c1-23(2,22(26)27)13-7-8-14-28-21-15-18(16-9-3-5-11-19(16)24)17-10-4-6-12-20(17)25-21/h3-6,9-12,15H,7-8,13-14H2,1-2H3,(H,26,27) |
| InChIKey | PBEVCBFJYRRJJH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|