C12H14ClFO3 — CID 117406092
4-[3-chloro-2-fluoro-5-(methoxymethyl)phenyl]butanoic acid (PubChem CID 117406092) has the molecular formula C12H14ClFO3 and a molecular weight of 260.69 g/mol. Its IUPAC name is 4-[3-chloro-2-fluoro-5-(methoxymethyl)phenyl]butanoic acid.
| Compound Name | 4-[3-chloro-2-fluoro-5-(methoxymethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117406092 |
| Molecular Formula | C12H14ClFO3 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-[3-chloro-2-fluoro-5-(methoxymethyl)phenyl]butanoic acid |
| SMILES | COCc1cc(Cl)c(F)c(CCCC(=O)O)c1 |
| InChI | InChI=1S/C12H14ClFO3/c1-17-7-8-5-9(3-2-4-11(15)16)12(14)10(13)6-8/h5-6H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | ZSXYODMEPXWCOO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |