About [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine
[5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine (PubChem CID 117406206) has the molecular formula C12H15ClF2N2
and a molecular weight of 260.71 g/mol. Its IUPAC name is [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine |
| PubChem CID | 117406206 |
| Molecular Formula | C12H15ClF2N2 |
| Molecular Weight | 260.71 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine |
| SMILES | CN1CC(CN)CC1c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C12H15ClF2N2/c1-17-6-7(5-16)2-12(17)8-3-9(13)11(15)4-10(8)14/h3-4,7,12H,2,5-6,16H2,1H3 |
| InChIKey | HGKYZBBWASNACC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine?
The IUPAC name of [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine (CID 117406206) is [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine is CN1CC(CN)CC1c1cc(Cl)c(F)cc1F.
What is the InChIKey of [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine?
The InChIKey is HGKYZBBWASNACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClF2N2/c1-17-6-7(5-16)2-12(17)8-3-9(13)11(15)4-10(8)14/h3-4,7,12H,2,5-6,16H2,1H3.
What are the key properties of [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine?
[5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine has a molecular weight of 260.71 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(5-chloro-2,4-difluorophenyl)-1-methylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 117406206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).