C22H29N3O3 — CID 11740690
6-propan-2-yl-3-(N-propylanilino)-6-[2-(1H-pyrazol-5-yl)ethyl]oxane-2,4-dione (PubChem CID 11740690) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 6-propan-2-yl-3-(N-propylanilino)-6-[2-(1H-pyrazol-5-yl)ethyl]oxane-2,4-dione.
| Compound Name | 6-propan-2-yl-3-(N-propylanilino)-6-[2-(1H-pyrazol-5-yl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 11740690 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 6-propan-2-yl-3-(N-propylanilino)-6-[2-(1H-pyrazol-5-yl)ethyl]oxane-2,4-dione |
| SMILES | CCCN(c1ccccc1)C1C(=O)CC(CCc2ccn[nH]2)(C(C)C)OC1=O |
| InChI | InChI=1S/C22H29N3O3/c1-4-14-25(18-8-6-5-7-9-18)20-19(26)15-22(16(2)3,28-21(20)27)12-10-17-11-13-23-24-17/h5-9,11,13,16,20H,4,10,12,14-15H2,1-3H3,(H,23,24) |
| InChIKey | AVMUEHHCOYTAPV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|