C13H11NO3S — CID 117407216
5-(1-isocyanatocyclobutyl)-1-benzothiophene 1,1-dioxide (PubChem CID 117407216) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is 5-(1-isocyanatocyclobutyl)-1-benzothiophene 1,1-dioxide.
| Compound Name | 5-(1-isocyanatocyclobutyl)-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 117407216 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 5-(1-isocyanatocyclobutyl)-1-benzothiophene 1,1-dioxide |
| SMILES | O=C=NC1(c2ccc3c(c2)C=CS3(=O)=O)CCC1 |
| InChI | InChI=1S/C13H11NO3S/c15-9-14-13(5-1-6-13)11-2-3-12-10(8-11)4-7-18(12,16)17/h2-4,7-8H,1,5-6H2 |
| InChIKey | OCKPMEIJOMJCRI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|