C16H23NO2 — CID 117408361
1-(6-propan-2-yl-1,3-benzodioxol-5-yl)cyclohexan-1-amine (PubChem CID 117408361) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-(6-propan-2-yl-1,3-benzodioxol-5-yl)cyclohexan-1-amine.
| Compound Name | 1-(6-propan-2-yl-1,3-benzodioxol-5-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 117408361 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-(6-propan-2-yl-1,3-benzodioxol-5-yl)cyclohexan-1-amine |
| SMILES | CC(C)c1cc2c(cc1C1(N)CCCCC1)OCO2 |
| InChI | InChI=1S/C16H23NO2/c1-11(2)12-8-14-15(19-10-18-14)9-13(12)16(17)6-4-3-5-7-16/h8-9,11H,3-7,10,17H2,1-2H3 |
| InChIKey | QJVDOYQWYVQSAI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |