C23H33NO2S — CID 11740942
(3S,8S,9S,10R,13S,14S,17S)-17-(4-methoxy-1,3-thiazol-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 11740942) has the molecular formula C23H33NO2S and a molecular weight of 387.59 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-(4-methoxy-1,3-thiazol-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-(4-methoxy-1,3-thiazol-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 11740942 |
| Molecular Formula | C23H33NO2S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-(4-methoxy-1,3-thiazol-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | COc1csc([C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)n1 |
| InChI | InChI=1S/C23H33NO2S/c1-22-10-8-15(25)12-14(22)4-5-16-17-6-7-19(21-24-20(26-3)13-27-21)23(17,2)11-9-18(16)22/h4,13,15-19,25H,5-12H2,1-3H3/t15-,16-,17-,18-,19+,22-,23-/m0/s1 |
| InChIKey | VNPGNQXUSSKBCO-FJHVXNPXSA-N |
| XLogP | 5.56 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|