C10H13BrFNO — CID 117409448
2-(4-aminobutan-2-yl)-6-bromo-3-fluorophenol (PubChem CID 117409448) has the molecular formula C10H13BrFNO and a molecular weight of 262.12 g/mol. Its IUPAC name is 2-(4-aminobutan-2-yl)-6-bromo-3-fluorophenol.
| Compound Name | 2-(4-aminobutan-2-yl)-6-bromo-3-fluorophenol |
|---|---|
| PubChem CID | 117409448 |
| Molecular Formula | C10H13BrFNO |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 2-(4-aminobutan-2-yl)-6-bromo-3-fluorophenol |
| SMILES | CC(CCN)c1c(F)ccc(Br)c1O |
| InChI | InChI=1S/C10H13BrFNO/c1-6(4-5-13)9-8(12)3-2-7(11)10(9)14/h2-3,6,14H,4-5,13H2,1H3 |
| InChIKey | XAYSZZHSYCLFLS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |