C21H25O5P — CID 11740966
[(1S,2R)-1-diphenylphosphoryl-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]butan-2-yl] acetate (PubChem CID 11740966) has the molecular formula C21H25O5P and a molecular weight of 388.40 g/mol. Its IUPAC name is [(1S,2R)-1-diphenylphosphoryl-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]butan-2-yl] acetate.
| Compound Name | [(1S,2R)-1-diphenylphosphoryl-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]butan-2-yl] acetate |
|---|---|
| PubChem CID | 11740966 |
| Molecular Formula | C21H25O5P |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(1S,2R)-1-diphenylphosphoryl-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]butan-2-yl] acetate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H]([C@@H]1O[C@H]1CO)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25O5P/c1-3-18(25-15(2)23)21(20-19(14-22)26-20)27(24,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18-22H,3,14H2,1-2H3/t18-,19+,20-,21+/m1/s1 |
| InChIKey | BRXQXGUSXHXWDG-MHTWAQMVSA-N |
| XLogP | 2.47 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|