C11H12F2O3S — CID 117409970
3-(2,3-difluoro-4-methylsulfonylphenyl)butanal (PubChem CID 117409970) has the molecular formula C11H12F2O3S and a molecular weight of 262.28 g/mol. Its IUPAC name is 3-(2,3-difluoro-4-methylsulfonylphenyl)butanal.
| Compound Name | 3-(2,3-difluoro-4-methylsulfonylphenyl)butanal |
|---|---|
| PubChem CID | 117409970 |
| Molecular Formula | C11H12F2O3S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-(2,3-difluoro-4-methylsulfonylphenyl)butanal |
| SMILES | CC(CC=O)c1ccc(S(C)(=O)=O)c(F)c1F |
| InChI | InChI=1S/C11H12F2O3S/c1-7(5-6-14)8-3-4-9(17(2,15)16)11(13)10(8)12/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | NPZJYVBJJMJTGC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|