About 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione
8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 11741027) has the molecular formula C22H29ClN2O2
and a molecular weight of 388.94 g/mol. Its IUPAC name is 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione.
Molecular Properties
| Compound Name | 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| PubChem CID | 11741027 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCc2cc(Cl)ccc2C1 |
| InChI | InChI=1S/C22H29ClN2O2/c23-19-6-5-18-16-24(12-7-17(18)13-19)10-3-4-11-25-20(26)14-22(15-21(25)27)8-1-2-9-22/h5-6,13H,1-4,7-12,14-16H2 |
| InChIKey | NQLGGYZENIWDCB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione?
The IUPAC name of 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione (CID 11741027) is 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione.
What is the SMILES notation for 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione?
The canonical SMILES for 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione is O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCc2cc(Cl)ccc2C1.
What is the InChIKey of 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione?
The InChIKey is NQLGGYZENIWDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29ClN2O2/c23-19-6-5-18-16-24(12-7-17(18)13-19)10-3-4-11-25-20(26)14-22(15-21(25)27)8-1-2-9-22/h5-6,13H,1-4,7-12,14-16H2.
What are the key properties of 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione?
8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione has a molecular weight of 388.94 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione is sourced from PubChem (CID 11741027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).