C16H20ClNO6S — CID 11741075
2,2-dimethylpropanoyloxymethyl (5R,6R)-3-(chloromethyl)-7-oxo-6-(2-oxopropyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 11741075) has the molecular formula C16H20ClNO6S and a molecular weight of 389.86 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (5R,6R)-3-(chloromethyl)-7-oxo-6-(2-oxopropyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (5R,6R)-3-(chloromethyl)-7-oxo-6-(2-oxopropyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 11741075 |
| Molecular Formula | C16H20ClNO6S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (5R,6R)-3-(chloromethyl)-7-oxo-6-(2-oxopropyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)C[C@@H]1C(=O)N2C(C(=O)OCOC(=O)C(C)(C)C)=C(CCl)S[C@H]12 |
| InChI | InChI=1S/C16H20ClNO6S/c1-8(19)5-9-12(20)18-11(10(6-17)25-13(9)18)14(21)23-7-24-15(22)16(2,3)4/h9,13H,5-7H2,1-4H3/t9-,13-/m1/s1 |
| InChIKey | DJGWEICNJPTHDO-NOZJJQNGSA-N |
| XLogP | 2.04 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|