C18H21N3O5S — CID 11741181
2-[4-[(2R)-2-[(4-carbamimidoylphenyl)sulfonylamino]propyl]phenoxy]acetic acid (PubChem CID 11741181) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[(4-carbamimidoylphenyl)sulfonylamino]propyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2R)-2-[(4-carbamimidoylphenyl)sulfonylamino]propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 11741181 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[4-[(2R)-2-[(4-carbamimidoylphenyl)sulfonylamino]propyl]phenoxy]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(S(=O)(=O)N[C@H](C)Cc2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-12(10-13-2-6-15(7-3-13)26-11-17(22)23)21-27(24,25)16-8-4-14(5-9-16)18(19)20/h2-9,12,21H,10-11H2,1H3,(H3,19,20)(H,22,23)/t12-/m1/s1 |
| InChIKey | IYFYLWLZDFJFCP-GFCCVEGCSA-N |
| XLogP | 1.34 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|