C12H13N3O4 — CID 117412054
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4,5-dimethoxybenzaldehyde (PubChem CID 117412054) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4,5-dimethoxybenzaldehyde.
| Compound Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 117412054 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(-c2noc(CN)n2)c1OC |
| InChI | InChI=1S/C12H13N3O4/c1-17-9-4-7(6-16)3-8(11(9)18-2)12-14-10(5-13)19-15-12/h3-4,6H,5,13H2,1-2H3 |
| InChIKey | NFBLSAKZCLQWFS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|