ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate

C14H14FNO3 — CID 117412157

IUPACethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate
SMILESCCOC(=O)C(=O)c1ccc2c(cc(C)n2C)c1F
InChIInChI=1S/C14H14FNO3/c1-4-19-14(18)13(17)9-5-6-11-10(12(9)15)7-8(2)16(11)3/h5-7H,4H2,1-3H3
InChIKeyIXRSZJHXEQMCTO-UHFFFAOYSA-N
MW263.27 g/mol
LogP2.37
Rot. Bonds3

About ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate

ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate (PubChem CID 117412157) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate.

Molecular Properties

Compound Nameethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate
PubChem CID117412157
Molecular FormulaC14H14FNO3
Molecular Weight263.27 g/mol
Exact Mass263.10
IUPAC Nameethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate
SMILESCCOC(=O)C(=O)c1ccc2c(cc(C)n2C)c1F
InChIInChI=1S/C14H14FNO3/c1-4-19-14(18)13(17)9-5-6-11-10(12(9)15)7-8(2)16(11)3/h5-7H,4H2,1-3H3
InChIKeyIXRSZJHXEQMCTO-UHFFFAOYSA-N
XLogP2.37
TPSA48.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.27
LogP ≤ 52.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate?
The IUPAC name of ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate (CID 117412157) is ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate.
What is the SMILES notation for ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate?
The canonical SMILES for ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate is CCOC(=O)C(=O)c1ccc2c(cc(C)n2C)c1F.
What is the InChIKey of ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate?
The InChIKey is IXRSZJHXEQMCTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNO3/c1-4-19-14(18)13(17)9-5-6-11-10(12(9)15)7-8(2)16(11)3/h5-7H,4H2,1-3H3.
What are the key properties of ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate?
ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate has a molecular weight of 263.27 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-fluoro-1,2-dimethylindol-5-yl)-2-oxoacetate is sourced from PubChem (CID 117412157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).