C14H14FNO3 — CID 117412158
ethyl 2-(7-fluoro-1,3-dimethylindol-5-yl)-2-oxoacetate (PubChem CID 117412158) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is ethyl 2-(7-fluoro-1,3-dimethylindol-5-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(7-fluoro-1,3-dimethylindol-5-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 117412158 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | ethyl 2-(7-fluoro-1,3-dimethylindol-5-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(F)c2c(c1)c(C)cn2C |
| InChI | InChI=1S/C14H14FNO3/c1-4-19-14(18)13(17)9-5-10-8(2)7-16(3)12(10)11(15)6-9/h5-7H,4H2,1-3H3 |
| InChIKey | UMIZDDJOOQHWTM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|