C14H17NO4 — CID 117412349
ethyl 2-hydroxy-2-(2-propan-2-yl-1,3-benzoxazol-5-yl)acetate (PubChem CID 117412349) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(2-propan-2-yl-1,3-benzoxazol-5-yl)acetate.
| Compound Name | ethyl 2-hydroxy-2-(2-propan-2-yl-1,3-benzoxazol-5-yl)acetate |
|---|---|
| PubChem CID | 117412349 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl 2-hydroxy-2-(2-propan-2-yl-1,3-benzoxazol-5-yl)acetate |
| SMILES | CCOC(=O)C(O)c1ccc2oc(C(C)C)nc2c1 |
| InChI | InChI=1S/C14H17NO4/c1-4-18-14(17)12(16)9-5-6-11-10(7-9)15-13(19-11)8(2)3/h5-8,12,16H,4H2,1-3H3 |
| InChIKey | ZFXDQWQFDRZSAJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |