About (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate
(1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate (PubChem CID 11741417) has the molecular formula C24H33N3O2
and a molecular weight of 395.55 g/mol. Its IUPAC name is (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate |
| PubChem CID | 11741417 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCC1CN(Cc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C24H33N3O2/c1-3-26(4-2)24(28)29-20-23-19-25(17-21-11-7-5-8-12-21)15-16-27(23)18-22-13-9-6-10-14-22/h5-14,23H,3-4,15-20H2,1-2H3 |
| InChIKey | DIPWPNLTJATONI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate?
The IUPAC name of (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate (CID 11741417) is (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate.
What is the SMILES notation for (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate?
The canonical SMILES for (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate is CCN(CC)C(=O)OCC1CN(Cc2ccccc2)CCN1Cc1ccccc1.
What is the InChIKey of (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate?
The InChIKey is DIPWPNLTJATONI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N3O2/c1-3-26(4-2)24(28)29-20-23-19-25(17-21-11-7-5-8-12-21)15-16-27(23)18-22-13-9-6-10-14-22/h5-14,23H,3-4,15-20H2,1-2H3.
What are the key properties of (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate?
(1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate has a molecular weight of 395.55 g/mol, XLogP of 3.85, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dibenzylpiperazin-2-yl)methyl N,N-diethylcarbamate is sourced from PubChem (CID 11741417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).