C21H17ClN2O4 — CID 11741483
11-(4-chlorophenyl)-7-phenyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone (PubChem CID 11741483) has the molecular formula C21H17ClN2O4 and a molecular weight of 396.83 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-7-phenyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone.
| Compound Name | 11-(4-chlorophenyl)-7-phenyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone |
|---|---|
| PubChem CID | 11741483 |
| Molecular Formula | C21H17ClN2O4 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 11-(4-chlorophenyl)-7-phenyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone |
| SMILES | O=C1CC(c2ccccc2)C2(C(=O)NC(=O)NC2=O)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H17ClN2O4/c22-14-8-6-13(7-9-14)17-11-15(25)10-16(12-4-2-1-3-5-12)21(17)18(26)23-20(28)24-19(21)27/h1-9,16-17H,10-11H2,(H2,23,24,26,27,28) |
| InChIKey | FJDZRKCDJOMHQW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|