C13H16N2O4 — CID 117414909
3-[2,5-dimethoxy-4-(methoxymethyl)phenyl]-1,2-oxazol-5-amine (PubChem CID 117414909) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[2,5-dimethoxy-4-(methoxymethyl)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[2,5-dimethoxy-4-(methoxymethyl)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117414909 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-[2,5-dimethoxy-4-(methoxymethyl)phenyl]-1,2-oxazol-5-amine |
| SMILES | COCc1cc(OC)c(-c2cc(N)on2)cc1OC |
| InChI | InChI=1S/C13H16N2O4/c1-16-7-8-4-12(18-3)9(5-11(8)17-2)10-6-13(14)19-15-10/h4-6H,7,14H2,1-3H3 |
| InChIKey | HKZLSFSOSVJZCF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |