C12H12N2O3S — CID 117414983
5-(3-hydroxy-4-methylsulfanylphenyl)-1-methylpyrazole-3-carboxylic acid (PubChem CID 117414983) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 5-(3-hydroxy-4-methylsulfanylphenyl)-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-(3-hydroxy-4-methylsulfanylphenyl)-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117414983 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-(3-hydroxy-4-methylsulfanylphenyl)-1-methylpyrazole-3-carboxylic acid |
| SMILES | CSc1ccc(-c2cc(C(=O)O)nn2C)cc1O |
| InChI | InChI=1S/C12H12N2O3S/c1-14-9(6-8(13-14)12(16)17)7-3-4-11(18-2)10(15)5-7/h3-6,15H,1-2H3,(H,16,17) |
| InChIKey | AIIKJYNIRBXLNT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |