About 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine
4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine (PubChem CID 117416678) has the molecular formula C12H12FN3O3
and a molecular weight of 265.24 g/mol. Its IUPAC name is 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine |
| PubChem CID | 117416678 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine |
| SMILES | COc1c(F)cc2c(c1-c1cn[nH]c1N)OCCO2 |
| InChI | InChI=1S/C12H12FN3O3/c1-17-10-7(13)4-8-11(19-3-2-18-8)9(10)6-5-15-16-12(6)14/h4-5H,2-3H2,1H3,(H3,14,15,16) |
| InChIKey | YQFCKSRENZZUBU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine?
The IUPAC name of 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine (CID 117416678) is 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine.
What is the SMILES notation for 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine?
The canonical SMILES for 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine is COc1c(F)cc2c(c1-c1cn[nH]c1N)OCCO2.
What is the InChIKey of 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine?
The InChIKey is YQFCKSRENZZUBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O3/c1-17-10-7(13)4-8-11(19-3-2-18-8)9(10)6-5-15-16-12(6)14/h4-5H,2-3H2,1H3,(H3,14,15,16).
What are the key properties of 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine?
4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine has a molecular weight of 265.24 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-fluoro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)-1H-pyrazol-5-amine is sourced from PubChem (CID 117416678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).