About tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate
tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate (PubChem CID 11741779) has the molecular formula C22H27NO4S
and a molecular weight of 401.53 g/mol. Its IUPAC name is tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate |
| PubChem CID | 11741779 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/S(=O)(=O)c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C22H27NO4S/c1-22(2,3)27-21(24)23-19(15-14-18-10-6-4-7-11-18)16-17-28(25,26)20-12-8-5-9-13-20/h4-13,16-17,19H,14-15H2,1-3H3,(H,23,24)/b17-16+/t19-/m0/s1 |
| InChIKey | AVUFAGOWJIRYNJ-PIOKWQJESA-N |
| XLogP | 4.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate (CID 11741779) is tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate is CC(C)(C)OC(=O)N[C@H](/C=C/S(=O)(=O)c1ccccc1)CCc1ccccc1.
What is the InChIKey of tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate?
The InChIKey is AVUFAGOWJIRYNJ-PIOKWQJESA-N. The full InChI is InChI=1S/C22H27NO4S/c1-22(2,3)27-21(24)23-19(15-14-18-10-6-4-7-11-18)16-17-28(25,26)20-12-8-5-9-13-20/h4-13,16-17,19H,14-15H2,1-3H3,(H,23,24)/b17-16+/t19-/m0/s1.
What are the key properties of tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate?
tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate has a molecular weight of 401.53 g/mol, XLogP of 4.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]carbamate is sourced from PubChem (CID 11741779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).