C24H22N2O2S — CID 11741843
6-(2-methylsulfonylpropan-2-yl)-8-(3-pyridin-3-ylphenyl)quinoline (PubChem CID 11741843) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 6-(2-methylsulfonylpropan-2-yl)-8-(3-pyridin-3-ylphenyl)quinoline.
| Compound Name | 6-(2-methylsulfonylpropan-2-yl)-8-(3-pyridin-3-ylphenyl)quinoline |
|---|---|
| PubChem CID | 11741843 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 6-(2-methylsulfonylpropan-2-yl)-8-(3-pyridin-3-ylphenyl)quinoline |
| SMILES | CC(C)(c1cc(-c2cccc(-c3cccnc3)c2)c2ncccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C24H22N2O2S/c1-24(2,29(3,27)28)21-14-19-9-6-12-26-23(19)22(15-21)18-8-4-7-17(13-18)20-10-5-11-25-16-20/h4-16H,1-3H3 |
| InChIKey | FLOHHFDEWSPOAZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |