C12H14N2O3S — CID 117419900
5-(2,4-dimethoxy-3-methylsulfanylphenyl)-1,2-oxazol-3-amine (PubChem CID 117419900) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-(2,4-dimethoxy-3-methylsulfanylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2,4-dimethoxy-3-methylsulfanylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117419900 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-(2,4-dimethoxy-3-methylsulfanylphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1ccc(-c2cc(N)no2)c(OC)c1SC |
| InChI | InChI=1S/C12H14N2O3S/c1-15-8-5-4-7(9-6-10(13)14-17-9)11(16-2)12(8)18-3/h4-6H,1-3H3,(H2,13,14) |
| InChIKey | WPAGAQGYLGLQLO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |