C14H15ClO3 — CID 117420690
ethyl 2-(4-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-2-oxoacetate (PubChem CID 117420690) has the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. Its IUPAC name is ethyl 2-(4-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(4-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 117420690 |
| Molecular Formula | C14H15ClO3 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | ethyl 2-(4-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(Cl)c2c(c1)CCCC2 |
| InChI | InChI=1S/C14H15ClO3/c1-2-18-14(17)13(16)10-7-9-5-3-4-6-11(9)12(15)8-10/h7-8H,2-6H2,1H3 |
| InChIKey | KBAPWPUIOJZNGN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|