C15H22FNO2 — CID 117421921
4-[3-(1-fluoroethyl)-4,5-dimethoxyphenyl]piperidine (PubChem CID 117421921) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-[3-(1-fluoroethyl)-4,5-dimethoxyphenyl]piperidine.
| Compound Name | 4-[3-(1-fluoroethyl)-4,5-dimethoxyphenyl]piperidine |
|---|---|
| PubChem CID | 117421921 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[3-(1-fluoroethyl)-4,5-dimethoxyphenyl]piperidine |
| SMILES | COc1cc(C2CCNCC2)cc(C(C)F)c1OC |
| InChI | InChI=1S/C15H22FNO2/c1-10(16)13-8-12(11-4-6-17-7-5-11)9-14(18-2)15(13)19-3/h8-11,17H,4-7H2,1-3H3 |
| InChIKey | FSIGAUMQHMTHML-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |