C17H21N3 — CID 117422207
1-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)cyclobutan-1-amine (PubChem CID 117422207) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)cyclobutan-1-amine.
| Compound Name | 1-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 117422207 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)cyclobutan-1-amine |
| SMILES | NC1(c2cccc3c4c([nH]c23)N2CCC4CC2)CCC1 |
| InChI | InChI=1S/C17H21N3/c18-17(7-2-8-17)13-4-1-3-12-14-11-5-9-20(10-6-11)16(14)19-15(12)13/h1,3-4,11,19H,2,5-10,18H2 |
| InChIKey | HQNFBXSHFXIVNR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |