C21H25Cl2NO3 — CID 11742274
2,6-ditert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-4-methoxycyclohexa-2,5-dien-1-one (PubChem CID 11742274) has the molecular formula C21H25Cl2NO3 and a molecular weight of 410.34 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-4-methoxycyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-4-methoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 11742274 |
| Molecular Formula | C21H25Cl2NO3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2,6-ditert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-4-methoxycyclohexa-2,5-dien-1-one |
| SMILES | COC1(N=C2C=C(Cl)C(=O)C(Cl)=C2)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C21H25Cl2NO3/c1-19(2,3)13-10-21(27-7,11-14(17(13)25)20(4,5)6)24-12-8-15(22)18(26)16(23)9-12/h8-11H,1-7H3 |
| InChIKey | MUKNDRWGCDXNSO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|