C25H33NO4 — CID 11742369
2-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 11742369) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 2-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]-5,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 11742369 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 2-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | CCN(CCCCC1Cc2cc(OC)c(OC)cc2C1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C25H33NO4/c1-5-26(17-19-11-6-7-12-22(19)28-2)13-9-8-10-18-14-20-15-23(29-3)24(30-4)16-21(20)25(18)27/h6-7,11-12,15-16,18H,5,8-10,13-14,17H2,1-4H3 |
| InChIKey | INXRDTYXVGUGFN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|