About methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate
methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate (PubChem CID 11742392) has the molecular formula C24H26ClNO3
and a molecular weight of 411.93 g/mol. Its IUPAC name is methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate.
Molecular Properties
| Compound Name | methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate |
| PubChem CID | 11742392 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate |
| SMILES | COC(=O)C(C)(C)CCCCOc1cc(-c2cccc(Cl)c2)c2ccccc2n1 |
| InChI | InChI=1S/C24H26ClNO3/c1-24(2,23(27)28-3)13-6-7-14-29-22-16-20(17-9-8-10-18(25)15-17)19-11-4-5-12-21(19)26-22/h4-5,8-12,15-16H,6-7,13-14H2,1-3H3 |
| InChIKey | JRNZCWDHJNWCDL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate?
The IUPAC name of methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate (CID 11742392) is methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate.
What is the SMILES notation for methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate?
The canonical SMILES for methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate is COC(=O)C(C)(C)CCCCOc1cc(-c2cccc(Cl)c2)c2ccccc2n1.
What is the InChIKey of methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate?
The InChIKey is JRNZCWDHJNWCDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26ClNO3/c1-24(2,23(27)28-3)13-6-7-14-29-22-16-20(17-9-8-10-18(25)15-17)19-11-4-5-12-21(19)26-22/h4-5,8-12,15-16H,6-7,13-14H2,1-3H3.
What are the key properties of methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate?
methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate has a molecular weight of 411.93 g/mol, XLogP of 6.30, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[4-(3-chlorophenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoate is sourced from PubChem (CID 11742392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).